| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:49 UTC |
|---|
| Update Date | 2025-03-21 18:05:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00056979 |
|---|
| Frequency | 55.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10NO8P |
|---|
| Molecular Mass | 243.0144 |
|---|
| SMILES | NC(COP(=O)(O)OCC(=O)O)C(=O)O |
|---|
| InChI Key | NCWIUQAZKFRHFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyl phosphatesdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolamines |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic aciddialkyl phosphatephosphoethanolamineorganic oxideorganic oxygen compoundphosphoric acid esterorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
