| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:49 UTC |
|---|
| Update Date | 2025-03-21 18:05:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00056985 |
|---|
| Frequency | 55.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H7O10PS |
|---|
| Molecular Mass | 265.9498 |
|---|
| SMILES | O=C(O)C(COP(=O)(O)O)OS(=O)(=O)O |
|---|
| InChI Key | HNXOHGYEFKTKEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | sugar acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidessulfuric acid monoesters |
|---|
| Substituents | aliphatic acyclic compoundsulfuric acid monoestercarbonyl groupcarboxylic acidorganic sulfuric acid or derivativescarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesphosphoric acid esterglyceric_acidmonoalkyl phosphatealkyl sulfatesulfate-esterhydrocarbon derivativesulfuric acid esterorganic phosphoric acid derivativealkyl phosphate |
|---|
