| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:51 UTC |
|---|
| Update Date | 2025-03-21 18:05:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057075 |
|---|
| Frequency | 55.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H24N2O6 |
|---|
| Molecular Mass | 364.1634 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OCC3CC(O)C(C(=O)O)O3)cc2)CC1 |
|---|
| InChI Key | DNNSSYVSFLGAPW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acidsaminophenyl ethersaniline and substituted anilinesazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethersdialkylarylamineshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-arylpiperazinesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundssecondary alcoholstertiary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidmonosaccharidealkyl aryl ethercarboxylic acid derivativedialkyl etherbeta-hydroxy acidsaccharideorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylamineaminophenyl ethertertiary amineacetamidealcoholazacycletetrahydrofurananiline or substituted anilineshydroxy acidcarboxamide groupphenylpiperazineoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
