| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:54 UTC |
|---|
| Update Date | 2025-03-21 18:05:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057190 |
|---|
| Frequency | 83.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15N5O4S |
|---|
| Molecular Mass | 313.0845 |
|---|
| SMILES | CSCC1OC(n2cnc3nc(N)[nH]c(=O)c32)C(O)C1O |
|---|
| InChI Key | PWHJYYQSJSMQNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsdialkylthioethersheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesnucleoside and nucleotide analoguesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidonessecondary alcoholssulfenyl compoundstetrahydrofurans |
|---|
| Substituents | lactammonosaccharidepyrimidoneimidazopyrimidineorganosulfur compoundpyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholsulfenyl compoundazacycletetrahydrofuranpurine nucleosidedialkylthioetherheteroaromatic compoundoxacycleorganic oxygen compoundthioethersecondary alcoholhypoxanthinehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|