| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:01 UTC |
|---|
| Update Date | 2025-03-21 18:05:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057452 |
|---|
| Frequency | 55.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H28ClFN4O4 |
|---|
| Molecular Mass | 514.1783 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OCC3COC(Cn4ccnc4)(c4ccc(F)cc4Cl)O3)cc2)CC1 |
|---|
| InChI Key | IUOAUUVPRAPCEX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesacetamidesalkyl aryl ethersamino acids and derivativesaminophenyl ethersaniline and substituted anilinesaryl chloridesaryl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzenesdialkylarylaminesfluorobenzenesheteroaromatic compoundshydrocarbon derivativesimidazolesketalsn-arylpiperazinesn-substituted imidazolesorganic oxidesorganochloridesorganofluoridesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundstertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietyamino acid or derivativesorganochlorideacetalketalorganonitrogen compoundaminophenyl etheracetamidearyl chloridechlorobenzeneazacycleheteroaromatic compoundaryl halidephenylpiperazinehydrocarbon derivativehalobenzenephenoxy compoundaminearyl fluoridemeta-dioxolanecarbonyl groupetheraromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativeorganohalogen compoundfluorobenzeneorganic oxideimidazoletertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganopnictogen compounddialkylarylaminetertiary amineazolen-substituted imidazoleorganofluorideaniline or substituted anilinescarboxamide groupoxacycleorganic oxygen compoundbenzenoidorganic nitrogen compoundn-arylpiperazineorganooxygen compound |
|---|