| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:01 UTC |
|---|
| Update Date | 2025-03-21 18:05:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057472 |
|---|
| Frequency | 55.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H8O6 |
|---|
| Molecular Mass | 284.0321 |
|---|
| SMILES | O=c1oc2c(O)c(O)cc3ccc4c(O)c(O)cc1c4c32 |
|---|
| InChI Key | DGTVTFBQLZTMGU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids2-benzopyranscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesnaphthols and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | benzopyran1-benzopyranphenanthrolheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidisocoumarincoumarinlactoneoxacycleorganic oxidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundpyran2-benzopyranpyranonehydrocarbon derivative1-naphthol2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|