| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:04 UTC |
|---|
| Update Date | 2025-03-21 18:05:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057597 |
|---|
| Frequency | 55.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19N4O9P |
|---|
| Molecular Mass | 454.089 |
|---|
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)C(=O)COP(=O)(O)O)c2cc1C |
|---|
| InChI Key | CWMCLAOGJOOOFU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | alloxazines and isoalloxazines |
|---|
| Direct Parent | flavins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacyloinsalpha-hydroxy ketonesazacyclic compoundsbenzenoidsbeta-hydroxy ketonesdiazanaphthalenesglycerone phosphatesheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrazinespyrimidonesquinoxalinessecondary alcohols |
|---|
| Substituents | beta-hydroxy ketonecarbonyl grouplactammonosaccharidepyrimidonealpha-hydroxy ketoneflavinpyrimidineketonesaccharideorganic oxidediazanaphthaleneglycerone or derivativesaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1,2-diolalcoholquinoxalinecarbonic acid derivativeazacycleheteroaromatic compoundglycerone phosphateorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrazineacyloinsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|