| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:06 UTC |
|---|
| Update Date | 2025-03-21 18:05:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057676 |
|---|
| Frequency | 55.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H23N3O2S |
|---|
| Molecular Mass | 381.1511 |
|---|
| SMILES | CC(=O)OCCN1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1 |
|---|
| InChI Key | ILNYZFJGEJVKIA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzothiazepines |
|---|
| Subclass | dibenzothiazepines |
|---|
| Direct Parent | dibenzothiazepines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amidinesamino acids and derivativesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acid estersdiarylthioethershydrocarbon derivativesimidolactamsmonocarboxylic acids and derivativesn-alkylpiperazinesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundstrialkylamines |
|---|
| Substituents | carbonyl groupamino acid or derivativesamidinecarboxylic acid derivativearyl thioetherpropargyl-type 1,3-dipolar organic compounddibenzothiazepineorganic oxidepiperazinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactamtertiary aminediarylthioetherazacyclen-alkylpiperazinetertiary aliphatic amineorganic 1,3-dipolar compoundmonocarboxylic acid or derivativesorganic oxygen compoundthioether1,4-diazinanecarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|