| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:09 UTC |
|---|
| Update Date | 2025-03-21 18:05:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057778 |
|---|
| Frequency | 54.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H36N2O3 |
|---|
| Molecular Mass | 472.2726 |
|---|
| SMILES | COc1ccc(C2(O)CCN(CCC(C(=O)N(C)C)(c3ccccc3)c3ccccc3)CC2)cc1 |
|---|
| InChI Key | UOGIRGRHEPJBHR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesanisolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesn-acyl aminesorganic oxidesorganopnictogen compoundsphenoxy compoundsphenylacetamidesphenylpiperidinestertiary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | diphenylmethanephenol ethercarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl ethercarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic aminecarboxamide groupmethoxybenzenen-acyl-aminetertiary alcoholorganic oxygen compoundphenylpiperidineanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
