| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:10 UTC |
|---|
| Update Date | 2025-03-21 18:05:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057837 |
|---|
| Frequency | 54.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H25NO3 |
|---|
| Molecular Mass | 267.1834 |
|---|
| SMILES | CCCNCC(O)COc1ccc(CCOC)cc1 |
|---|
| InChI Key | IJUQLJSYFOIGBV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersdialkyl ethersdialkylamineshydrocarbon derivativesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary alcohols |
|---|
| Substituents | alcoholphenol ethersecondary aliphatic aminemonocyclic benzene moietyetheralkyl aryl ethersecondary aminedialkyl etheraromatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativetyrosol derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compoundamine |
|---|
