| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:11 UTC |
|---|
| Update Date | 2025-03-21 18:05:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057843 |
|---|
| Frequency | 54.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7O6P |
|---|
| Molecular Mass | 217.998 |
|---|
| SMILES | O=C(OP(=O)(O)O)c1ccc(O)cc1 |
|---|
| InChI Key | UTOJICFXSSCXLL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacyl phosphatesbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compounds |
|---|
| Substituents | benzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativeorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|