| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:13 UTC |
|---|
| Update Date | 2025-03-21 18:05:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00057940 |
|---|
| Frequency | 54.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15Cl2N2O13P3 |
|---|
| Molecular Mass | 533.9164 |
|---|
| SMILES | O=c1ccn(C2CC(O)C(COP(=O)(O)OP(=O)(O)C(Cl)(Cl)P(=O)(O)O)O2)c(=O)[nH]1 |
|---|
| InChI Key | PRGJEEDPWKQTHA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl chloridesazacyclic compoundsbisphosphonatesheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundspyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactamaromatic heteromonocyclic compoundpentose phosphatealkyl chlorideorganochloridepyrimidoneorganohalogen compoundpyrimidineorganic oxideorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundalkyl halideorganophosphonic acid derivativeorganoheterocyclic compoundalcoholvinylogous amidebisphosphonatecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|