| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:16 UTC |
|---|
| Update Date | 2025-03-21 18:05:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00058048 |
|---|
| Frequency | 54.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H18N2O4S2 |
|---|
| Molecular Mass | 282.0708 |
|---|
| SMILES | NC(CCSSCCC(N)C(=O)O)CC(=O)O |
|---|
| InChI Key | DNOLQVQCJFIISY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | beta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdialkyldisulfidesdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfenyl compoundsthia fatty acids |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidsulfenyl compoundfatty acidalpha-amino acid or derivativesorganosulfur compoundbeta amino acid or derivativesdialkyldisulfideorganic oxidethia fatty acidorganic oxygen compoundorganic disulfideorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|