| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:17 UTC |
|---|
| Update Date | 2025-03-21 18:05:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00058089 |
|---|
| Frequency | 54.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H22N2O3 |
|---|
| Molecular Mass | 290.163 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OCC3COC3)cc2)CC1 |
|---|
| InChI Key | ZCFWKAABLADLSQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acids and derivativesaminophenyl ethersaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl ethersdialkylarylamineshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxetanesphenoxy compoundstertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl ethercarboxylic acid derivativedialkyl etherorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylamineaminophenyl ethertertiary amineacetamideazacycleaniline or substituted anilinescarboxamide groupphenylpiperazineoxacycleorganic oxygen compoundoxetanehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
