| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:17 UTC |
|---|
| Update Date | 2025-03-21 18:05:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00058090 |
|---|
| Frequency | 60.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H9N5 |
|---|
| Molecular Mass | 211.0858 |
|---|
| SMILES | Nc1nc(-c2ccccc2)nc2nc[nH]c12 |
|---|
| InChI Key | YKMJOAVCSAOXOU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | monocyclic benzene moietyazacycleheteroaromatic compoundpyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aminepurineorganic nitrogen compoundimidolactamamineazole |
|---|
