DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-20 23:58:17 UTC
Update Date	2025-03-21 18:05:39 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID00058098
Frequency	54.5
Structure
Chemical Formula	C₂₄H₂₅N₃O₁₀
Molecular Mass	515.154
SMILES	O=C(O)CCC(NC(=O)c1ccc(Nc2ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc2)cc1)C(=O)O
InChI Key	FCFXTMFIBSHETM-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	glutamic acid and derivatives
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	alpha amino acids amino acids benzoyl derivatives carbonyl compounds carboxylic acids hippuric acids and derivatives hydrocarbon derivatives n-acyl-alpha amino acids organic oxides organopnictogen compounds secondary amines secondary carboxylic acid amides tetracarboxylic acids and derivatives
Substituents	monocyclic benzene moiety carbonyl group carboxylic acid amino acid benzoyl benzamide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound n-acyl-alpha amino acid or derivatives n-acyl-alpha-amino acid hippuric acid or derivatives benzoic acid or derivatives tetracarboxylic acid or derivatives glutamic acid or derivatives secondary amine carboxamide group aromatic homomonocyclic compound secondary carboxylic acid amide organic oxygen compound hydrocarbon derivative benzenoid organic nitrogen compound organooxygen compound amine

Showing information for DMID00058098