| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:18 UTC |
|---|
| Update Date | 2025-03-21 18:05:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00058124 |
|---|
| Frequency | 54.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O6 |
|---|
| Molecular Mass | 274.0477 |
|---|
| SMILES | Oc1cc(O)c2cc(-c3cc(O)c(O)c(O)c3)oc2c1 |
|---|
| InChI Key | KVFHNKSIDPYFCC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | 2-arylbenzofuran flavonoids |
|---|
| Subclass | 2-arylbenzofuran flavonoids |
|---|
| Direct Parent | 2-arylbenzofuran flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesbenzofuransfuransheteroaromatic compoundshydrocarbon derivativesorganooxygen compoundsoxacyclic compoundspyrogallols and derivatives |
|---|
| Substituents | furanmonocyclic benzene moietypyrogallol derivativebenzofuran2-arylbenzofuran flavonoidbenzenetriolheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundaromatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
