| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:20 UTC |
|---|
| Update Date | 2025-03-21 18:05:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00058199 |
|---|
| Frequency | 54.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20NO4+ |
|---|
| Molecular Mass | 350.1387 |
|---|
| SMILES | CCOc1ccc2cc3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2 |
|---|
| InChI Key | YSZODONOBKJUNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | protoberberine alkaloids and derivatives |
|---|
| Subclass | protoberberine alkaloids and derivatives |
|---|
| Direct Parent | protoberberine alkaloids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesacetalsalkyl aryl ethersanisolesazacyclic compoundsbenzodioxolesheteroaromatic compoundshydrocarbon derivativesisoquinolines and derivativesmethylpyridinesorganic cationsorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspolyhalopyridinesquinolizines |
|---|
| Substituents | tetrahydroprotoberberine skeletonphenol etheretherpolyhalopyridinealkyl aryl etheracetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridineorganic cationorganoheterocyclic compoundbenzodioxolequinolizineazacycleheteroaromatic compoundmethylpyridineprotoberberine skeletonoxacyclepyridineorganic oxygen compoundanisoleisoquinolinehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|