| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:23 UTC |
|---|
| Update Date | 2025-03-21 18:05:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00058335 |
|---|
| Frequency | 54.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14O3S |
|---|
| Molecular Mass | 226.0664 |
|---|
| SMILES | CC(C(=O)O)c1ccc(CS(C)=O)cc1 |
|---|
| InChI Key | NUMQCNAWLDBKIZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic monoterpenoidsbenzyl alkyl sulfoxidescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidessulfinyl compoundssulfoxides |
|---|
| Substituents | monoterpenoidmonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidcarboxylic acidp-cymeneorganosulfur compoundcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidsulfinyl compoundbenzyl sulfoxidesulfoxidehydrocarbon derivativebenzenoidbenzyl alkyl sulfoxideorganooxygen compoundaromatic monoterpenoid |
|---|
