| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:29 UTC |
|---|
| Update Date | 2025-03-21 18:05:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00058556 |
|---|
| Frequency | 53.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H9I4NO3 |
|---|
| Molecular Mass | 746.6761 |
|---|
| SMILES | NC(=O)Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
|---|
| InChI Key | MNMHUDWTDPTECO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl iodidescarbonyl compoundscarboxylic acids and derivativesdiarylethershalophenolshydrocarbon derivativesiodobenzeneso-iodophenolsorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsphenylacetamidesprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidediaryl etherphenol ethercarbonyl groupethercarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxideorganonitrogen compoundorganopnictogen compoundphenylacetamide2-iodophenolcarboxamide grouparyl halidearomatic homomonocyclic compound2-halophenolorganic oxygen compoundphenolhydrocarbon derivativearyl iodideorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
