| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:36 UTC |
|---|
| Update Date | 2025-03-21 18:05:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00058860 |
|---|
| Frequency | 53.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N5O6P |
|---|
| Molecular Mass | 331.0682 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C2O[PH](O)(O)OC21 |
|---|
| InChI Key | SUGYMPXVUZSRSJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidines and pyrimidine derivativestetrahydrofurans |
|---|
| Substituents | pyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxygen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|