| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:39 UTC |
|---|
| Update Date | 2025-03-21 18:05:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00058947 |
|---|
| Frequency | 53.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N2O |
|---|
| Molecular Mass | 218.1419 |
|---|
| SMILES | CN(C)CCN1C(=O)CCc2ccccc21 |
|---|
| InChI Key | DPCBQEZRQXVNJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | quinolones and derivatives |
|---|
| Direct Parent | hydroquinolones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeshydroquinolineslactamsorganic oxidesorganopnictogen compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | tetrahydroquinolonecarbonyl grouplactamazacycleamino acid or derivativestertiary aliphatic aminecarboxamide groupcarboxylic acid derivativeorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundtetrahydroquinolineaminetertiary amineorganooxygen compound |
|---|