| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:41 UTC |
|---|
| Update Date | 2025-03-21 18:05:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059027 |
|---|
| Frequency | 53.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N2O2 |
|---|
| Molecular Mass | 206.1055 |
|---|
| SMILES | CN1C(=O)CCCC1c1ccc[n+]([O-])c1 |
|---|
| InChI Key | LHCLECVLRMFOLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | Not Available |
|---|
| Subclass | alkaloids and derivatives |
|---|
| Direct Parent | alkaloids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdelta lactamsheteroaromatic compoundshydrocarbon derivativesmethylpyridinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinonestertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamaromatic heteromonocyclic compoundazacycleheteroaromatic compoundmethylpyridinecarboxamide groupcarboxylic acid derivativedelta-lactamorganic oxidealkaloid or derivativespyridineorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinonehydrocarbon derivativeorganic nitrogen compoundpiperidineorganoheterocyclic compoundorganooxygen compound |
|---|
