| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:42 UTC |
|---|
| Update Date | 2025-03-21 18:05:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059078 |
|---|
| Frequency | 53.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H4Cl2O4 |
|---|
| Molecular Mass | 221.9487 |
|---|
| SMILES | O=C(O)c1cc(Cl)c(O)c(Cl)c1O |
|---|
| InChI Key | FCOWQHCAVUUGCS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | dichlorobenzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds3-halobenzoic acidsaryl chloridesbenzoyl derivativesdichlorobenzeneshalobenzoic acidshalophenolshydrocarbon derivativesmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochloridesorganooxygen compoundsp-chlorophenolsresorcinolssalicylic acidsvinylogous acids |
|---|
| Substituents | carboxylic acid3-halobenzoic acid or derivativesorganochloridebenzoylsalicylic acidcarboxylic acid derivativeorganohalogen compoundresorcinol1,3-dichlorobenzeneorganic oxide3-halobenzoic acid4-halophenol3,5-dichlorobenzoic acid1-carboxy-2-haloaromatic compoundaryl chloride2-chlorophenolchlorobenzenehalobenzoic acid4-chlorophenolhalobenzoic acid or derivativesaryl halidehydroxybenzoic acidaromatic homomonocyclic compound2-halophenolvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesphenolhydrocarbon derivativehalobenzeneorganooxygen compound |
|---|
