| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:58:44 UTC |
|---|
| Update Date | 2025-03-21 18:05:49 UTC |
|---|
| HMDB ID | HMDB0135689 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059163 |
|---|
| Name | 4-(4-hydroxy-3,5-dimethoxyphenyl)but-3-en-2-one |
|---|
| Frequency | 53.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14O4 |
|---|
| Molecular Mass | 222.0892 |
|---|
| SMILES | COc1cc(C=CC(C)=O)cc(OC)c1O |
|---|
| InChI Key | OOFWCWCUKUVTKD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsalkyl aryl ethersanisolesdimethoxybenzenesenoneshydrocarbon derivativesketonesmethoxyphenolsorganic oxidesphenoxy compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethermethoxyphenolalkyl aryl etheralpha,beta-unsaturated ketoneketonedimethoxybenzeneorganic oxideenonemethoxybenzenehydroxycinnamic acidaromatic homomonocyclic compoundorganic oxygen compoundm-dimethoxybenzeneanisolephenolhydrocarbon derivativebenzenoidacryloyl-groupphenoxy compoundorganooxygen compound |
|---|
