| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:46 UTC |
|---|
| Update Date | 2025-03-21 18:05:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059237 |
|---|
| Frequency | 53.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O5 |
|---|
| Molecular Mass | 286.0841 |
|---|
| SMILES | COc1cc2c(cc1O)C(=O)C(c1ccc(O)cc1)CO2 |
|---|
| InChI Key | XOUQQKHTVYQPNF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | o-methylated isoflavonoids |
|---|
| Direct Parent | 7-o-methylated isoflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesaryl alkyl ketonesbenzene and substituted derivativeschromoneshydrocarbon derivativesisoflavanolsisoflavanonesorganic oxidesoxacyclic compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketone1-benzopyranisoflavanol1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherisoflavanoneketoneorganic oxidechromonearomatic heteropolycyclic compoundchromaneorganoheterocyclic compoundisoflavanbenzopyranoxacycleorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoid7-methoxyisoflavonoid-skeletonorganooxygen compoundaryl ketone |
|---|
