| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:47 UTC |
|---|
| Update Date | 2025-03-21 18:05:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059275 |
|---|
| Frequency | 53.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H11NO10S2 |
|---|
| Molecular Mass | 308.9824 |
|---|
| SMILES | O=S(=O)(O)NC1C(O)OC(COS(=O)(=O)O)C1O |
|---|
| InChI Key | LYGBBBOWFRZARX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfateshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholssulfuric acid monoamidestetrahydrofurans |
|---|
| Substituents | alcoholsulfuric acid monoestertetrahydrofuranmonosaccharideoxacyclesaccharideorganic oxideorganic oxygen compoundalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundsulfuric acid monoamidesecondary alcoholorganopnictogen compoundsulfate-esterhemiacetalhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|