| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:58:51 UTC |
|---|
| Update Date | 2025-03-21 18:05:51 UTC |
|---|
| HMDB ID | HMDB0258573 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059437 |
|---|
| Name | Sulfaguanidine |
|---|
| Frequency | 62.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10N4O2S |
|---|
| Molecular Mass | 214.0524 |
|---|
| SMILES | NC(N)=NS(=O)(=O)c1ccc(N)cc1 |
|---|
| InChI Key | BRBKOPJOKNSWSG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzenesulfonyl compoundsguanidineshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acids and derivativesprimary aminessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesbenzenesulfonamideguanidineorganosulfur compoundaromatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundaminebenzenesulfonyl group |
|---|
