| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:52 UTC |
|---|
| Update Date | 2025-03-21 18:05:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059470 |
|---|
| Frequency | 52.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H6Cl8O |
|---|
| Molecular Mass | 421.7927 |
|---|
| SMILES | OC1C(Cl)C(Cl)C2C1C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl |
|---|
| InChI Key | QOZNAOLUFNBJFJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclic alcohols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl chlorideschloroalkeneschlorohydrinshydrocarbon derivativesorganochloridessecondary alcoholsvinyl chlorides |
|---|
| Substituents | chlorohydrinhalohydrinalkyl chloridechloroalkeneorganochloridecyclic alcoholorganohalogen compoundaliphatic homopolycyclic compoundvinyl halidehaloalkenesecondary alcoholalkyl halidehydrocarbon derivativevinyl chloride |
|---|