| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:55 UTC |
|---|
| Update Date | 2025-03-21 18:05:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059601 |
|---|
| Frequency | 52.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO11S |
|---|
| Molecular Mass | 409.0679 |
|---|
| SMILES | O=C(CO)Nc1ccccc1OC1OC(COS(=O)(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | OQRQQMHVYOHCIV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl sulfatescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesn-arylamidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundssecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | phenol ethersulfuric acid monoestercarbonyl grouparomatic heteromonocyclic compoundmonosacchariden-arylamidecarboxylic acid derivativesaccharideorganic oxideacetalalkyl sulfateorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholorganic sulfuric acid or derivativescarboxamide groupanilideoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
