| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:58:58 UTC |
|---|
| Update Date | 2025-03-21 18:05:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059713 |
|---|
| Frequency | 52.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N3O4 |
|---|
| Molecular Mass | 239.0906 |
|---|
| SMILES | O=c1[nH]cc(CNC2C=CC(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | UDMBMCUALATJHN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsdialkylaminesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundssecondary alcoholsvinylogous amides |
|---|
| Substituents | alcoholvinylogous amidesecondary aliphatic aminecarbonic acid derivativelactamaromatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidonesecondary amineorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine1,2-diol |
|---|
