| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:01 UTC |
|---|
| Update Date | 2025-03-21 18:05:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059850 |
|---|
| Frequency | 52.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H24FNO |
|---|
| Molecular Mass | 265.1842 |
|---|
| SMILES | CN(C)CC(c1ccc(F)cc1)C1(O)CCCCC1 |
|---|
| InChI Key | WEACXCYJCZVORV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | fluorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcoholsaryl fluoridescyclic alcohols and derivativescyclohexanolshydrocarbon derivativesorganofluoridesorganopnictogen compoundstertiary alcoholstrialkylamines |
|---|
| Substituents | aryl fluoridealcohol1,3-aminoalcoholorganofluoridetertiary aliphatic aminecyclohexanolcyclic alcoholorganohalogen compoundaryl halidearomatic homomonocyclic compoundfluorobenzenetertiary alcoholorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
