| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:02 UTC |
|---|
| Update Date | 2025-03-21 18:05:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059891 |
|---|
| Frequency | 52.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17N3O5 |
|---|
| Molecular Mass | 283.1168 |
|---|
| SMILES | Cn1cnc(CC(NC(=O)OC2CCOC2)C(=O)O)c1 |
|---|
| InChI Key | ROAHFGBMHUQXLK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbamate esterscarbonyl compoundscarboxylic acidsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesimidazolesmonocarboxylic acids and derivativesn-substituted imidazolesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | carbonyl groupethercarboxylic acidaromatic heteromonocyclic compounddialkyl etherorganic oxideimidazoleorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazolen-substituted imidazolecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundcarbamic acid esteroxacyclemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|