| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:05 UTC |
|---|
| Update Date | 2025-03-21 18:05:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059984 |
|---|
| Frequency | 52.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C5HF11O2S |
|---|
| Molecular Mass | 333.9522 |
|---|
| SMILES | O=S(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
| InChI Key | VWOZJJGGBQGKFY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | sulfinic acids and derivatives |
|---|
| Subclass | sulfinic acids |
|---|
| Direct Parent | sulfinic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkanesulfinic acids and derivativesalkyl fluorideshydrocarbon derivativesorganic oxidesorganofluoridesorganosulfur compounds |
|---|
| Substituents | aliphatic acyclic compoundalkyl fluorideorganofluorideorganosulfur compoundorganohalogen compoundsulfinic acidalkanesulfinic acid or derivativesorganic oxideorganic oxygen compoundalkyl halidehydrocarbon derivative |
|---|