| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:59:05 UTC |
|---|
| Update Date | 2025-03-21 18:05:56 UTC |
|---|
| HMDB ID | HMDB0130400 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059987 |
|---|
| Name | 3,5,7-trihydroxy-2-(2,3,4-trihydroxyphenyl)-1λ⁴-chromen-1-ylium |
|---|
| Frequency | 52.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H11O7+ |
|---|
| Molecular Mass | 303.0499 |
|---|
| SMILES | Oc1cc(O)c2cc(O)c(-c3ccc(O)c(O)c3O)[o+]c2c1 |
|---|
| InChI Key | RPCGLCONYKFGDK-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 3-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids5-unsubstituted pyrrogallols7-hydroxyflavonoidsanthocyanidinsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | 3-hydroxyflavonoidmonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoid5-unsubstituted pyrrogallolaromatic heteropolycyclic compoundanthocyanidinorganic cationorganoheterocyclic compoundbenzopyranpyrogallol derivativebenzenetriolheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|