| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:05 UTC |
|---|
| Update Date | 2025-03-21 18:05:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00059993 |
|---|
| Frequency | 52.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H7F3O3 |
|---|
| Molecular Mass | 232.0347 |
|---|
| SMILES | O=C(O)C=Cc1ccc(OC(F)(F)F)cc1 |
|---|
| InChI Key | RNYVTJANWYBGPW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesphenol ethersphenoxy compoundstrihalomethanes |
|---|
| Substituents | halomethanephenol ethermonocyclic benzene moietycarbonyl grouptrihalomethanecarboxylic acidalkyl fluorideorganofluoridecarboxylic acid derivativeorganohalogen compoundaromatic homomonocyclic compoundcinnamic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl halidehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
