| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:07 UTC |
|---|
| Update Date | 2025-03-21 18:05:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060076 |
|---|
| Frequency | 52.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N2O7P |
|---|
| Molecular Mass | 290.0304 |
|---|
| SMILES | O=c1ccn(C2CC(O)C3OP(=O)(O)OC32)c(=O)[nH]1 |
|---|
| InChI Key | HAHHQJOUNMDXFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclopentyl nucleosides |
|---|
| Direct Parent | cyclopentyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic alcohols and derivativesdioxaphospholanesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | alcoholvinylogous amidecarbonic acid derivativelactamazacycleheteroaromatic compoundpyrimidone1,3_dioxaphospholanecyclic alcoholpyrimidineoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganoheterocyclic compoundorganooxygen compoundcyclopentyl nucleoside |
|---|