| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:09 UTC |
|---|
| Update Date | 2025-03-21 18:05:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060146 |
|---|
| Frequency | 52.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N2O13P2 |
|---|
| Molecular Mass | 434.0128 |
|---|
| SMILES | O=c1ccn(C2OC(COP(=O)(O)O)C(OP(=O)(O)O)C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | SWDGUCUQKZAAAC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactamaromatic heteromonocyclic compoundpyrimidonepyrimidineorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compound1,2-diolalcoholvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|