| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:13 UTC |
|---|
| Update Date | 2025-03-21 18:05:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060342 |
|---|
| Frequency | 51.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O5S |
|---|
| Molecular Mass | 218.0249 |
|---|
| SMILES | Cc1ccc(OS(=O)(=O)O)c(O)c1C |
|---|
| InChI Key | JQHNTICCZZBEGO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesmeta cresolsorganic oxidesorganooxygen compoundsortho cresolsphenoxy compoundssulfuric acid monoesterso-xylenes |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterm-cresol1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundxylenephenylsulfateorganic oxideo-xyleneorganic oxygen compoundo-cresolsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|