| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:17 UTC |
|---|
| Update Date | 2025-03-21 18:06:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060493 |
|---|
| Frequency | 51.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO6 |
|---|
| Molecular Mass | 297.1212 |
|---|
| SMILES | O=C(Cc1ccccc1)NC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | DCOSGHYDXOSEHQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholcarbonyl grouparomatic heteromonocyclic compoundmonosaccharidecarboxamide groupcarboxylic acid derivativeoxacyclesecondary carboxylic acid amidesaccharideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundoxaneprimary alcoholphenylacetamideorganoheterocyclic compoundorganooxygen compound |
|---|
