| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:18 UTC |
|---|
| Update Date | 2025-03-21 18:06:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060526 |
|---|
| Frequency | 51.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O6 |
|---|
| Molecular Mass | 286.0477 |
|---|
| SMILES | O=C1Oc2cc(O)cc(O)c2C(=O)C1c1ccc(O)cc1 |
|---|
| InChI Key | YNZFLVVAPCENQF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavans |
|---|
| Direct Parent | isoflavanones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3,4-dihydrocoumarins3-arylcoumarin flavonoidsaryl alkyl ketonesbenzene and substituted derivativescarboxylic acid esterschromoneshydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsvinylogous acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparyl alkyl ketone1-benzopyran1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeisoflavanoneketonelactoneorganic oxidechromonearomatic heteropolycyclic compoundchromaneorganoheterocyclic compoundbenzopyran3,4-dihydrocoumarin1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativebenzenoid1,3-dicarbonyl compound3-arylcoumarin flavonoidorganooxygen compoundaryl ketone |
|---|
