| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:21 UTC |
|---|
| Update Date | 2025-03-21 18:06:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060632 |
|---|
| Frequency | 51.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12N2 |
|---|
| Molecular Mass | 196.1 |
|---|
| SMILES | Cc1cnc(C)c2c1[nH]c1ccccc12 |
|---|
| InChI Key | JTDZFYLVOCFRRG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | pyridoindoles |
|---|
| Direct Parent | gamma carbolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyridines and derivativespyrrolespyrrolopyridines |
|---|
| Substituents | azacyclepyrrolopyridineindolepolyhalopyridinegamma-carbolineheteroaromatic compoundpyridinearomatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoid2-halopyridineorganic nitrogen compound |
|---|
