| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:21 UTC |
|---|
| Update Date | 2025-03-21 18:06:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060654 |
|---|
| Frequency | 51.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N3O9P |
|---|
| Molecular Mass | 323.0155 |
|---|
| SMILES | O=c1[nH]c(=O)n(C2OC(CO)C3OP(=O)(O)OC32)c(=O)[nH]1 |
|---|
| InChI Key | YPIDOCQYBVDTHT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | triazines |
|---|
| Subclass | triazinones |
|---|
| Direct Parent | triazinones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3,5-triazinesazacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative1,3,5-triazineorganic nitrogen compoundprimary alcoholorganic phosphoric acid derivativetriazinoneorganooxygen compound |
|---|
