| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:23 UTC |
|---|
| Update Date | 2025-03-21 18:06:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060724 |
|---|
| Frequency | 51.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H32N6O18P2 |
|---|
| Molecular Mass | 718.1248 |
|---|
| SMILES | CC(=O)NC1C(O)CC(O)(C(=O)O)OC1C(O)C(O)COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
|---|
| InChI Key | VAZQRLSATWYZPW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | purine ribonucleotides |
|---|
| Direct Parent | purine ribonucleoside diphosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesalpha hydroxy acids and derivativesamino acidsazacyclic compoundsc-glucuronidescarbonyl compoundscarboxylic acidshemiacetalsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-substituted imidazolesorganic oxidesorganic pyrophosphatesorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary aminespurine ribonucleoside monophosphatespurines and purine derivativespyran carboxylic acidspyrimidines and pyrimidine derivativessecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carboxylic acidamino acid or derivativespurine ribonucleoside monophosphatemonosaccharidepentose-5-phosphateimidazopyrimidinepyran carboxylic acidsaccharidepurine ribonucleoside diphosphateorganonitrogen compoundhemiacetaloxaneorganoheterocyclic compoundacetamidec-glucuronidealcoholazacycleheteroaromatic compoundorganic pyrophosphatesecondary carboxylic acid amidemonoalkyl phosphatehydrocarbon derivativeprimary amineaminecarbonyl grouppentose phosphateamino acidalpha-hydroxy acidcarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganopnictogen compoundimidolactamazolen-substituted imidazolepyran carboxylic acid or derivativestetrahydrofuranhydroxy acidcarboxamide groupoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterpyransecondary alcoholpurineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|