| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:27 UTC |
|---|
| Update Date | 2025-03-21 18:06:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060905 |
|---|
| Frequency | 51.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O7 |
|---|
| Molecular Mass | 318.074 |
|---|
| SMILES | O=C(O)c1c(O)cc(O)c(C(=O)CCc2ccc(O)cc2)c1O |
|---|
| InChI Key | WNYALUAJRMXSNB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | 2'-hydroxy-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl-phenylketonesaryl alkyl ketonesbenzoic acidsbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundssalicylic acidsvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety2'-hydroxy-dihydrochalconecarboxylic acidaryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolsalicylic acidcarboxylic acid derivativeketonephloroglucinol derivativeorganic oxide1-carboxy-2-haloaromatic compoundbenzoic acidacylphloroglucinol derivativebenzenetriolbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidphenylketonehydroxybenzoic acidbutyrophenonearomatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
