| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:28 UTC |
|---|
| Update Date | 2025-03-21 18:06:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060906 |
|---|
| Frequency | 51.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H6N2O5S |
|---|
| Molecular Mass | 193.9997 |
|---|
| SMILES | O=C1CC(C(=O)O)NS(=O)(=O)N1 |
|---|
| InChI Key | KVDSYKVFXDGXMR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic sulfuric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsthiadiazinanes |
|---|
| Substituents | thiadiazinanecarbonyl groupcarboxylic acidorganic sulfuric acid or derivativesazacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|