| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:28 UTC |
|---|
| Update Date | 2025-03-21 18:06:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060927 |
|---|
| Frequency | 51.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H7F2NO3 |
|---|
| Molecular Mass | 227.0394 |
|---|
| SMILES | O=C(O)c1c[nH]c2ccc(OC(F)F)cc12 |
|---|
| InChI Key | PVFJCOSHTHYNBT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indolecarboxylic acids and derivatives |
|---|
| Direct Parent | indolecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsalkyl fluoridesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsphenol etherspyrrole carboxylic acidsvinylogous amides |
|---|
| Substituents | phenol ethercarboxylic acidpyrrole-3-carboxylic acid or derivativesindolecarboxylic acid derivativeorganohalogen compoundorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalkyl halide1-carboxy-2-haloaromatic compoundindolecarboxylic acid derivativevinylogous amideazacyclealkyl fluorideorganofluorideheteroaromatic compoundmonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundpyrrole-3-carboxylic acidorganooxygen compound |
|---|