| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:28 UTC |
|---|
| Update Date | 2025-03-21 18:06:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060928 |
|---|
| Frequency | 51.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H16O5 |
|---|
| Molecular Mass | 312.0998 |
|---|
| SMILES | COc1cc2c(c3oc(=O)c4c(c13)CCC4=O)C=CC(C)(C)O2 |
|---|
| InChI Key | ZUYHOYDEBBENNK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | pyranocoumarins |
|---|
| Direct Parent | angular pyranocoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2,2-dimethyl-1-benzopyransalkyl aryl ethersanisolesaryl alkyl ketonesheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundspyranochromenespyranones and derivatives |
|---|
| Substituents | phenol etheretheraryl alkyl ketone1-benzopyran2,2-dimethyl-1-benzopyranalkyl aryl etherangular pyranocoumarinketonelactoneorganic oxidearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranpyranochromeneheteroaromatic compoundoxacycleorganic oxygen compoundpyrananisolehydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|