| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:28 UTC |
|---|
| Update Date | 2025-03-21 18:06:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060942 |
|---|
| Frequency | 51.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H11NO3 |
|---|
| Molecular Mass | 241.0739 |
|---|
| SMILES | Nc1ccccc1C(=O)c1ccccc1C(=O)O |
|---|
| InChI Key | KORKIRUGUNPQML-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsamino acidsaryl ketonesaryl-phenylketonesbenzoic acidsbenzoyl derivativesdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminesvinylogous amides |
|---|
| Substituents | diphenylmethanecarboxylic acidamino acid or derivativesamino acidbenzoylcarboxylic acid derivativebenzophenoneketoneorganic oxideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidvinylogous amidearyl-phenylketonebenzoic acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundaryl ketone |
|---|