| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:29 UTC |
|---|
| Update Date | 2025-03-21 18:06:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00060950 |
|---|
| Frequency | 58.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8N5O5P |
|---|
| Molecular Mass | 273.0263 |
|---|
| SMILES | Nc1nc2ncc(COP(=O)(O)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | AJXFJEHKGGCFNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidones |
|---|
| Substituents | pterinlactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundphosphoric acid esteraromatic heteropolycyclic compoundmonoalkyl phosphatepyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
